C25H19BrN2O3S2 — CID 156749759
N-[2,3-bis(ethenyl)-4-hydroxy-5-quinolin-8-ylsulfanylphenyl]-4-bromobenzenesulfonamide (PubChem CID 156749759) has the molecular formula C25H19BrN2O3S2 and a molecular weight of 539.48 g/mol. Its IUPAC name is N-[2,3-bis(ethenyl)-4-hydroxy-5-quinolin-8-ylsulfanylphenyl]-4-bromobenzenesulfonamide.
| Compound Name | N-[2,3-bis(ethenyl)-4-hydroxy-5-quinolin-8-ylsulfanylphenyl]-4-bromobenzenesulfonamide |
|---|---|
| PubChem CID | 156749759 |
| Molecular Formula | C25H19BrN2O3S2 |
| Molecular Weight | 539.48 g/mol |
| Exact Mass | 538.00 |
| IUPAC Name | N-[2,3-bis(ethenyl)-4-hydroxy-5-quinolin-8-ylsulfanylphenyl]-4-bromobenzenesulfonamide |
| SMILES | C=Cc1c(NS(=O)(=O)c2ccc(Br)cc2)cc(Sc2cccc3cccnc23)c(O)c1C=C |
| InChI | InChI=1S/C25H19BrN2O3S2/c1-3-19-20(4-2)25(29)23(32-22-9-5-7-16-8-6-14-27-24(16)22)15-21(19)28-33(30,31)18-12-10-17(26)11-13-18/h3-15,28-29H,1-2H2 |
| InChIKey | CKBNCKLZUKZRDE-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.48 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|