C25H24N3O5S2+ — CID 143906970
[(3E)-4-[[2,3-bis(ethenyl)-4-hydroxy-5-quinolin-8-ylsulfanylphenyl]sulfamoyl]penta-1,3-dien-2-yl]-methoxy-oxoazanium (PubChem CID 143906970) has the molecular formula C25H24N3O5S2+ and a molecular weight of 510.62 g/mol. Its IUPAC name is [(3E)-4-[[2,3-bis(ethenyl)-4-hydroxy-5-quinolin-8-ylsulfanylphenyl]sulfamoyl]penta-1,3-dien-2-yl]-methoxy-oxoazanium.
| Compound Name | [(3E)-4-[[2,3-bis(ethenyl)-4-hydroxy-5-quinolin-8-ylsulfanylphenyl]sulfamoyl]penta-1,3-dien-2-yl]-methoxy-oxoazanium |
|---|---|
| PubChem CID | 143906970 |
| Molecular Formula | C25H24N3O5S2+ |
| Molecular Weight | 510.62 g/mol |
| Exact Mass | 510.12 |
| IUPAC Name | [(3E)-4-[[2,3-bis(ethenyl)-4-hydroxy-5-quinolin-8-ylsulfanylphenyl]sulfamoyl]penta-1,3-dien-2-yl]-methoxy-oxoazanium |
| SMILES | C=Cc1c(NS(=O)(=O)/C(C)=C/C(=C)[N+](=O)OC)cc(Sc2cccc3cccnc23)c(O)c1C=C |
| InChI | InChI=1S/C25H23N3O5S2/c1-6-19-20(7-2)25(29)23(34-22-12-8-10-18-11-9-13-26-24(18)22)15-21(19)27-35(31,32)17(4)14-16(3)28(30)33-5/h6-15,27H,1-3H2,4-5H3/p+1/b17-14+ |
| InChIKey | AJJNCWLSAJPZOE-SAPNQHFASA-O |
| XLogP | 5.88 |
| TPSA | 108.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.62 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|