C24H19ClN2O3S2 — CID 143906950
(2E)-4-chloro-N-(4-hydroxy-3-quinolin-8-ylsulfanylnaphthalen-1-yl)penta-2,4-diene-2-sulfonamide (PubChem CID 143906950) has the molecular formula C24H19ClN2O3S2 and a molecular weight of 483.01 g/mol. Its IUPAC name is (2E)-4-chloro-N-(4-hydroxy-3-quinolin-8-ylsulfanylnaphthalen-1-yl)penta-2,4-diene-2-sulfonamide.
| Compound Name | (2E)-4-chloro-N-(4-hydroxy-3-quinolin-8-ylsulfanylnaphthalen-1-yl)penta-2,4-diene-2-sulfonamide |
|---|---|
| PubChem CID | 143906950 |
| Molecular Formula | C24H19ClN2O3S2 |
| Molecular Weight | 483.01 g/mol |
| Exact Mass | 482.05 |
| IUPAC Name | (2E)-4-chloro-N-(4-hydroxy-3-quinolin-8-ylsulfanylnaphthalen-1-yl)penta-2,4-diene-2-sulfonamide |
| SMILES | C=C(Cl)/C=C(\C)S(=O)(=O)Nc1cc(Sc2cccc3cccnc23)c(O)c2ccccc12 |
| InChI | InChI=1S/C24H19ClN2O3S2/c1-15(25)13-16(2)32(29,30)27-20-14-22(24(28)19-10-4-3-9-18(19)20)31-21-11-5-7-17-8-6-12-26-23(17)21/h3-14,27-28H,1H2,2H3/b16-13+ |
| InChIKey | RBZNVDDXICYCPF-DTQAZKPQSA-N |
| XLogP | 6.64 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.01 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|