C22H21NO3S2 — CID 143906947
(2E)-N-(4-hydroxy-3-phenylsulfanylnaphthalen-1-yl)-4-methylpenta-2,4-diene-2-sulfonamide (PubChem CID 143906947) has the molecular formula C22H21NO3S2 and a molecular weight of 411.55 g/mol. Its IUPAC name is (2E)-N-(4-hydroxy-3-phenylsulfanylnaphthalen-1-yl)-4-methylpenta-2,4-diene-2-sulfonamide.
| Compound Name | (2E)-N-(4-hydroxy-3-phenylsulfanylnaphthalen-1-yl)-4-methylpenta-2,4-diene-2-sulfonamide |
|---|---|
| PubChem CID | 143906947 |
| Molecular Formula | C22H21NO3S2 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | (2E)-N-(4-hydroxy-3-phenylsulfanylnaphthalen-1-yl)-4-methylpenta-2,4-diene-2-sulfonamide |
| SMILES | C=C(C)/C=C(\C)S(=O)(=O)Nc1cc(Sc2ccccc2)c(O)c2ccccc12 |
| InChI | InChI=1S/C22H21NO3S2/c1-15(2)13-16(3)28(25,26)23-20-14-21(27-17-9-5-4-6-10-17)22(24)19-12-8-7-11-18(19)20/h4-14,23-24H,1H2,2-3H3/b16-13+ |
| InChIKey | UZVZMECFECOVJU-DTQAZKPQSA-N |
| XLogP | 5.92 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|