C23H15BrF3NO3S2 — CID 58565705
4-bromo-N-(4-hydroxy-3-phenylsulfanylnaphthalen-1-yl)-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 58565705) has the molecular formula C23H15BrF3NO3S2 and a molecular weight of 554.41 g/mol. Its IUPAC name is 4-bromo-N-(4-hydroxy-3-phenylsulfanylnaphthalen-1-yl)-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | 4-bromo-N-(4-hydroxy-3-phenylsulfanylnaphthalen-1-yl)-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 58565705 |
| Molecular Formula | C23H15BrF3NO3S2 |
| Molecular Weight | 554.41 g/mol |
| Exact Mass | 552.96 |
| IUPAC Name | 4-bromo-N-(4-hydroxy-3-phenylsulfanylnaphthalen-1-yl)-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1cc(Sc2ccccc2)c(O)c2ccccc12)c1ccc(Br)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H15BrF3NO3S2/c24-19-11-10-15(12-18(19)23(25,26)27)33(30,31)28-20-13-21(32-14-6-2-1-3-7-14)22(29)17-9-5-4-8-16(17)20/h1-13,28-29H |
| InChIKey | PJPLEEOFAXKWFJ-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.41 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|