C19H17NO3S2 — CID 143906959
(E)-N-(4-hydroxy-3-phenylsulfanylnaphthalen-1-yl)prop-1-ene-1-sulfonamide (PubChem CID 143906959) has the molecular formula C19H17NO3S2 and a molecular weight of 371.48 g/mol. Its IUPAC name is (E)-N-(4-hydroxy-3-phenylsulfanylnaphthalen-1-yl)prop-1-ene-1-sulfonamide.
| Compound Name | (E)-N-(4-hydroxy-3-phenylsulfanylnaphthalen-1-yl)prop-1-ene-1-sulfonamide |
|---|---|
| PubChem CID | 143906959 |
| Molecular Formula | C19H17NO3S2 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.06 |
| IUPAC Name | (E)-N-(4-hydroxy-3-phenylsulfanylnaphthalen-1-yl)prop-1-ene-1-sulfonamide |
| SMILES | C/C=C/S(=O)(=O)Nc1cc(Sc2ccccc2)c(O)c2ccccc12 |
| InChI | InChI=1S/C19H17NO3S2/c1-2-12-25(22,23)20-17-13-18(24-14-8-4-3-5-9-14)19(21)16-11-7-6-10-15(16)17/h2-13,20-21H,1H3/b12-2+ |
| InChIKey | SBGRUXHEAAVZCU-SWGQDTFXSA-N |
| XLogP | 4.97 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|