C24H20ClNO3S2 — CID 25040306
4-chloro-N-[4-hydroxy-3-(4-methylphenyl)sulfanylnaphthalen-1-yl]-3-methylbenzenesulfonamide (PubChem CID 25040306) has the molecular formula C24H20ClNO3S2 and a molecular weight of 470.02 g/mol. Its IUPAC name is 4-chloro-N-[4-hydroxy-3-(4-methylphenyl)sulfanylnaphthalen-1-yl]-3-methylbenzenesulfonamide.
| Compound Name | 4-chloro-N-[4-hydroxy-3-(4-methylphenyl)sulfanylnaphthalen-1-yl]-3-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 25040306 |
| Molecular Formula | C24H20ClNO3S2 |
| Molecular Weight | 470.02 g/mol |
| Exact Mass | 469.06 |
| IUPAC Name | 4-chloro-N-[4-hydroxy-3-(4-methylphenyl)sulfanylnaphthalen-1-yl]-3-methylbenzenesulfonamide |
| SMILES | Cc1ccc(Sc2cc(NS(=O)(=O)c3ccc(Cl)c(C)c3)c3ccccc3c2O)cc1 |
| InChI | InChI=1S/C24H20ClNO3S2/c1-15-7-9-17(10-8-15)30-23-14-22(19-5-3-4-6-20(19)24(23)27)26-31(28,29)18-11-12-21(25)16(2)13-18/h3-14,26-27H,1-2H3 |
| InChIKey | ALSMEEIWWGPXCP-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.02 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|