C24H21NO3S2 — CID 1297152
N-(3-benzylsulfanyl-4-hydroxynaphthalen-1-yl)-4-methylbenzenesulfonamide (PubChem CID 1297152) has the molecular formula C24H21NO3S2 and a molecular weight of 435.57 g/mol. Its IUPAC name is N-(3-benzylsulfanyl-4-hydroxynaphthalen-1-yl)-4-methylbenzenesulfonamide.
| Compound Name | N-(3-benzylsulfanyl-4-hydroxynaphthalen-1-yl)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 1297152 |
| Molecular Formula | C24H21NO3S2 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.10 |
| IUPAC Name | N-(3-benzylsulfanyl-4-hydroxynaphthalen-1-yl)-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2cc(SCc3ccccc3)c(O)c3ccccc23)cc1 |
| InChI | InChI=1S/C24H21NO3S2/c1-17-11-13-19(14-12-17)30(27,28)25-22-15-23(29-16-18-7-3-2-4-8-18)24(26)21-10-6-5-9-20(21)22/h2-15,25-26H,16H2,1H3 |
| InChIKey | GXZYFDRDXGRSHJ-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|