C25H20ClNO5S2 — CID 90348657
2-[4-[[3-[(4-chlorophenyl)methyl]phenyl]sulfonylamino]-1-hydroxynaphthalen-2-yl]sulfanylacetic acid (PubChem CID 90348657) has the molecular formula C25H20ClNO5S2 and a molecular weight of 514.02 g/mol. Its IUPAC name is 2-[4-[[3-[(4-chlorophenyl)methyl]phenyl]sulfonylamino]-1-hydroxynaphthalen-2-yl]sulfanylacetic acid.
| Compound Name | 2-[4-[[3-[(4-chlorophenyl)methyl]phenyl]sulfonylamino]-1-hydroxynaphthalen-2-yl]sulfanylacetic acid |
|---|---|
| PubChem CID | 90348657 |
| Molecular Formula | C25H20ClNO5S2 |
| Molecular Weight | 514.02 g/mol |
| Exact Mass | 513.05 |
| IUPAC Name | 2-[4-[[3-[(4-chlorophenyl)methyl]phenyl]sulfonylamino]-1-hydroxynaphthalen-2-yl]sulfanylacetic acid |
| SMILES | O=C(O)CSc1cc(NS(=O)(=O)c2cccc(Cc3ccc(Cl)cc3)c2)c2ccccc2c1O |
| InChI | InChI=1S/C25H20ClNO5S2/c26-18-10-8-16(9-11-18)12-17-4-3-5-19(13-17)34(31,32)27-22-14-23(33-15-24(28)29)25(30)21-7-2-1-6-20(21)22/h1-11,13-14,27,30H,12,15H2,(H,28,29) |
| InChIKey | BSFKYXPMMRYCJX-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.02 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|