C20H20ClNO5S3 — CID 143924227
2-[4-[(5-butan-2-yl-4-chlorothiophen-2-yl)sulfonylamino]-1-hydroxynaphthalen-2-yl]sulfanylacetic acid (PubChem CID 143924227) has the molecular formula C20H20ClNO5S3 and a molecular weight of 486.04 g/mol. Its IUPAC name is 2-[4-[(5-butan-2-yl-4-chlorothiophen-2-yl)sulfonylamino]-1-hydroxynaphthalen-2-yl]sulfanylacetic acid.
| Compound Name | 2-[4-[(5-butan-2-yl-4-chlorothiophen-2-yl)sulfonylamino]-1-hydroxynaphthalen-2-yl]sulfanylacetic acid |
|---|---|
| PubChem CID | 143924227 |
| Molecular Formula | C20H20ClNO5S3 |
| Molecular Weight | 486.04 g/mol |
| Exact Mass | 485.02 |
| IUPAC Name | 2-[4-[(5-butan-2-yl-4-chlorothiophen-2-yl)sulfonylamino]-1-hydroxynaphthalen-2-yl]sulfanylacetic acid |
| SMILES | CCC(C)c1sc(S(=O)(=O)Nc2cc(SCC(=O)O)c(O)c3ccccc23)cc1Cl |
| InChI | InChI=1S/C20H20ClNO5S3/c1-3-11(2)20-14(21)8-18(29-20)30(26,27)22-15-9-16(28-10-17(23)24)19(25)13-7-5-4-6-12(13)15/h4-9,11,22,25H,3,10H2,1-2H3,(H,23,24) |
| InChIKey | HCNMCYSQDJVJCH-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.04 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|