C16H15NO3S3 — CID 46908186
N-(3-ethylsulfanyl-4-hydroxynaphthalen-1-yl)thiophene-2-sulfonamide (PubChem CID 46908186) has the molecular formula C16H15NO3S3 and a molecular weight of 365.50 g/mol. Its IUPAC name is N-(3-ethylsulfanyl-4-hydroxynaphthalen-1-yl)thiophene-2-sulfonamide.
| Compound Name | N-(3-ethylsulfanyl-4-hydroxynaphthalen-1-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 46908186 |
| Molecular Formula | C16H15NO3S3 |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.02 |
| IUPAC Name | N-(3-ethylsulfanyl-4-hydroxynaphthalen-1-yl)thiophene-2-sulfonamide |
| SMILES | CCSc1cc(NS(=O)(=O)c2cccs2)c2ccccc2c1O |
| InChI | InChI=1S/C16H15NO3S3/c1-2-21-14-10-13(11-6-3-4-7-12(11)16(14)18)17-23(19,20)15-8-5-9-22-15/h3-10,17-18H,2H2,1H3 |
| InChIKey | FBDCTYOJYCGNDI-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|