C25H20N2O3S3 — CID 90231674
N-[4-hydroxy-3-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]methyl]naphthalen-1-yl]thiophene-2-sulfonamide (PubChem CID 90231674) has the molecular formula C25H20N2O3S3 and a molecular weight of 492.65 g/mol. Its IUPAC name is N-[4-hydroxy-3-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]methyl]naphthalen-1-yl]thiophene-2-sulfonamide.
| Compound Name | N-[4-hydroxy-3-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]methyl]naphthalen-1-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 90231674 |
| Molecular Formula | C25H20N2O3S3 |
| Molecular Weight | 492.65 g/mol |
| Exact Mass | 492.06 |
| IUPAC Name | N-[4-hydroxy-3-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]methyl]naphthalen-1-yl]thiophene-2-sulfonamide |
| SMILES | Cc1ccc(-c2csc(Cc3cc(NS(=O)(=O)c4cccs4)c4ccccc4c3O)n2)cc1 |
| InChI | InChI=1S/C25H20N2O3S3/c1-16-8-10-17(11-9-16)22-15-32-23(26-22)14-18-13-21(19-5-2-3-6-20(19)25(18)28)27-33(29,30)24-7-4-12-31-24/h2-13,15,27-28H,14H2,1H3 |
| InChIKey | HSLINGOQGWPFFX-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.65 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|