C16H14N5O3S3+ — CID 137126428
N-[4-hydroxy-3-(2-methyltetrazol-2-ium-1-yl)sulfanylnaphthalen-1-yl]thiophene-2-sulfonamide (PubChem CID 137126428) has the molecular formula C16H14N5O3S3+ and a molecular weight of 420.52 g/mol. Its IUPAC name is N-[4-hydroxy-3-(2-methyltetrazol-2-ium-1-yl)sulfanylnaphthalen-1-yl]thiophene-2-sulfonamide.
| Compound Name | N-[4-hydroxy-3-(2-methyltetrazol-2-ium-1-yl)sulfanylnaphthalen-1-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 137126428 |
| Molecular Formula | C16H14N5O3S3+ |
| Molecular Weight | 420.52 g/mol |
| Exact Mass | 420.03 |
| IUPAC Name | N-[4-hydroxy-3-(2-methyltetrazol-2-ium-1-yl)sulfanylnaphthalen-1-yl]thiophene-2-sulfonamide |
| SMILES | C[n+]1nncn1Sc1cc(NS(=O)(=O)c2cccs2)c2ccccc2c1O |
| InChI | InChI=1S/C16H13N5O3S3/c1-20-19-17-10-21(20)26-14-9-13(11-5-2-3-6-12(11)16(14)22)18-27(23,24)15-7-4-8-25-15/h2-10,19H,1H3/p+1 |
| InChIKey | MMIHJZIEILVOAP-UHFFFAOYSA-O |
| XLogP | 2.38 |
| TPSA | 100.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.52 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|