C20H20N2O4S3 — CID 44609144
N-cyclopropyl-3-[1-hydroxy-4-(thiophen-2-ylsulfonylamino)naphthalen-2-yl]sulfanylpropanamide (PubChem CID 44609144) has the molecular formula C20H20N2O4S3 and a molecular weight of 448.59 g/mol. Its IUPAC name is N-cyclopropyl-3-[1-hydroxy-4-(thiophen-2-ylsulfonylamino)naphthalen-2-yl]sulfanylpropanamide.
| Compound Name | N-cyclopropyl-3-[1-hydroxy-4-(thiophen-2-ylsulfonylamino)naphthalen-2-yl]sulfanylpropanamide |
|---|---|
| PubChem CID | 44609144 |
| Molecular Formula | C20H20N2O4S3 |
| Molecular Weight | 448.59 g/mol |
| Exact Mass | 448.06 |
| IUPAC Name | N-cyclopropyl-3-[1-hydroxy-4-(thiophen-2-ylsulfonylamino)naphthalen-2-yl]sulfanylpropanamide |
| SMILES | O=C(CCSc1cc(NS(=O)(=O)c2cccs2)c2ccccc2c1O)NC1CC1 |
| InChI | InChI=1S/C20H20N2O4S3/c23-18(21-13-7-8-13)9-11-27-17-12-16(14-4-1-2-5-15(14)20(17)24)22-29(25,26)19-6-3-10-28-19/h1-6,10,12-13,22,24H,7-9,11H2,(H,21,23) |
| InChIKey | GPYUIWYLZMSSOP-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.59 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|