C24H20N2O6S4 — CID 25037398
N-[3-(2,6-dioxocyclohexyl)-4-(thiophen-2-ylsulfonylamino)naphthalen-1-yl]thiophene-2-sulfonamide (PubChem CID 25037398) has the molecular formula C24H20N2O6S4 and a molecular weight of 560.70 g/mol. Its IUPAC name is N-[3-(2,6-dioxocyclohexyl)-4-(thiophen-2-ylsulfonylamino)naphthalen-1-yl]thiophene-2-sulfonamide.
| Compound Name | N-[3-(2,6-dioxocyclohexyl)-4-(thiophen-2-ylsulfonylamino)naphthalen-1-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 25037398 |
| Molecular Formula | C24H20N2O6S4 |
| Molecular Weight | 560.70 g/mol |
| Exact Mass | 560.02 |
| IUPAC Name | N-[3-(2,6-dioxocyclohexyl)-4-(thiophen-2-ylsulfonylamino)naphthalen-1-yl]thiophene-2-sulfonamide |
| SMILES | O=C1CCCC(=O)C1c1cc(NS(=O)(=O)c2cccs2)c2ccccc2c1NS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C24H20N2O6S4/c27-19-8-3-9-20(28)23(19)17-14-18(25-35(29,30)21-10-4-12-33-21)15-6-1-2-7-16(15)24(17)26-36(31,32)22-11-5-13-34-22/h1-2,4-7,10-14,23,25-26H,3,8-9H2 |
| InChIKey | MPWPGTRSNGDZSY-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 126.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.70 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulfonamide_D(2)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|