C18H18N2O4S3 — CID 91363626
3-[1-hydroxy-4-(thiophen-2-ylsulfonylamino)naphthalen-2-yl]sulfanylbutanamide (PubChem CID 91363626) has the molecular formula C18H18N2O4S3 and a molecular weight of 422.55 g/mol. Its IUPAC name is 3-[1-hydroxy-4-(thiophen-2-ylsulfonylamino)naphthalen-2-yl]sulfanylbutanamide.
| Compound Name | 3-[1-hydroxy-4-(thiophen-2-ylsulfonylamino)naphthalen-2-yl]sulfanylbutanamide |
|---|---|
| PubChem CID | 91363626 |
| Molecular Formula | C18H18N2O4S3 |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.04 |
| IUPAC Name | 3-[1-hydroxy-4-(thiophen-2-ylsulfonylamino)naphthalen-2-yl]sulfanylbutanamide |
| SMILES | CC(CC(N)=O)Sc1cc(NS(=O)(=O)c2cccs2)c2ccccc2c1O |
| InChI | InChI=1S/C18H18N2O4S3/c1-11(9-16(19)21)26-15-10-14(12-5-2-3-6-13(12)18(15)22)20-27(23,24)17-7-4-8-25-17/h2-8,10-11,20,22H,9H2,1H3,(H2,19,21) |
| InChIKey | NDTXOSQJGXFNGG-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|