C20H18NO5S2- — CID 7720329
(2S)-2-[1-hydroxy-4-[(4-methylphenyl)sulfonylamino]naphthalen-2-yl]sulfanylpropanoate (PubChem CID 7720329) has the molecular formula C20H18NO5S2- and a molecular weight of 416.50 g/mol. Its IUPAC name is (2S)-2-[1-hydroxy-4-[(4-methylphenyl)sulfonylamino]naphthalen-2-yl]sulfanylpropanoate.
| Compound Name | (2S)-2-[1-hydroxy-4-[(4-methylphenyl)sulfonylamino]naphthalen-2-yl]sulfanylpropanoate |
|---|---|
| PubChem CID | 7720329 |
| Molecular Formula | C20H18NO5S2- |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.06 |
| IUPAC Name | (2S)-2-[1-hydroxy-4-[(4-methylphenyl)sulfonylamino]naphthalen-2-yl]sulfanylpropanoate |
| SMILES | Cc1ccc(S(=O)(=O)Nc2cc(SC(C)C(=O)[O-])c(O)c3ccccc23)cc1 |
| InChI | InChI=1S/C20H19NO5S2/c1-12-7-9-14(10-8-12)28(25,26)21-17-11-18(27-13(2)20(23)24)19(22)16-6-4-3-5-15(16)17/h3-11,13,21-22H,1-2H3,(H,23,24)/p-1 |
| InChIKey | PTTGXYOHSYHNDY-UHFFFAOYSA-M |
| XLogP | 2.89 |
| TPSA | 106.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|