C30H30N2O7S2 — CID 2835145
ethyl 2-[1,4-bis[(4-methylphenyl)sulfonylamino]naphthalen-2-yl]-3-oxobutanoate (PubChem CID 2835145) has the molecular formula C30H30N2O7S2 and a molecular weight of 594.71 g/mol. Its IUPAC name is ethyl 2-[1,4-bis[(4-methylphenyl)sulfonylamino]naphthalen-2-yl]-3-oxobutanoate.
| Compound Name | ethyl 2-[1,4-bis[(4-methylphenyl)sulfonylamino]naphthalen-2-yl]-3-oxobutanoate |
|---|---|
| PubChem CID | 2835145 |
| Molecular Formula | C30H30N2O7S2 |
| Molecular Weight | 594.71 g/mol |
| Exact Mass | 594.15 |
| IUPAC Name | ethyl 2-[1,4-bis[(4-methylphenyl)sulfonylamino]naphthalen-2-yl]-3-oxobutanoate |
| SMILES | CCOC(=O)C(C(C)=O)c1cc(NS(=O)(=O)c2ccc(C)cc2)c2ccccc2c1NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C30H30N2O7S2/c1-5-39-30(34)28(21(4)33)26-18-27(31-40(35,36)22-14-10-19(2)11-15-22)24-8-6-7-9-25(24)29(26)32-41(37,38)23-16-12-20(3)13-17-23/h6-18,28,31-32H,5H2,1-4H3 |
| InChIKey | YFFGETRTCCAJLJ-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 135.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.71 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfonamide_D(2)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|