C27H28N4O7S2 — CID 177442010
6-ethoxy-N-[4-[(6-ethoxy-3-pyridinyl)sulfonylamino]-3-(2-oxopropyl)naphthalen-1-yl]pyridine-3-sulfonamide (PubChem CID 177442010) has the molecular formula C27H28N4O7S2 and a molecular weight of 584.68 g/mol. Its IUPAC name is 6-ethoxy-N-[4-[(6-ethoxy-3-pyridinyl)sulfonylamino]-3-(2-oxopropyl)naphthalen-1-yl]pyridine-3-sulfonamide.
| Compound Name | 6-ethoxy-N-[4-[(6-ethoxy-3-pyridinyl)sulfonylamino]-3-(2-oxopropyl)naphthalen-1-yl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 177442010 |
| Molecular Formula | C27H28N4O7S2 |
| Molecular Weight | 584.68 g/mol |
| Exact Mass | 584.14 |
| IUPAC Name | 6-ethoxy-N-[4-[(6-ethoxy-3-pyridinyl)sulfonylamino]-3-(2-oxopropyl)naphthalen-1-yl]pyridine-3-sulfonamide |
| SMILES | CCOc1ccc(S(=O)(=O)Nc2cc(CC(C)=O)c(NS(=O)(=O)c3ccc(OCC)nc3)c3ccccc23)cn1 |
| InChI | InChI=1S/C27H28N4O7S2/c1-4-37-25-12-10-20(16-28-25)39(33,34)30-24-15-19(14-18(3)32)27(23-9-7-6-8-22(23)24)31-40(35,36)21-11-13-26(29-17-21)38-5-2/h6-13,15-17,30-31H,4-5,14H2,1-3H3 |
| InChIKey | IZMLRUYZIQOXRF-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 153.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.68 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulfonamide_D(2)', 'substructure': 'N/A'} |
|---|