C22H19NO6S — CID 16761798
5-[(4-ethoxyphenyl)sulfonylamino]-2-methylbenzo[g][1]benzofuran-3-carboxylic acid (PubChem CID 16761798) has the molecular formula C22H19NO6S and a molecular weight of 425.46 g/mol. Its IUPAC name is 5-[(4-ethoxyphenyl)sulfonylamino]-2-methylbenzo[g][1]benzofuran-3-carboxylic acid.
| Compound Name | 5-[(4-ethoxyphenyl)sulfonylamino]-2-methylbenzo[g][1]benzofuran-3-carboxylic acid |
|---|---|
| PubChem CID | 16761798 |
| Molecular Formula | C22H19NO6S |
| Molecular Weight | 425.46 g/mol |
| Exact Mass | 425.09 |
| IUPAC Name | 5-[(4-ethoxyphenyl)sulfonylamino]-2-methylbenzo[g][1]benzofuran-3-carboxylic acid |
| SMILES | CCOc1ccc(S(=O)(=O)Nc2cc3c(C(=O)O)c(C)oc3c3ccccc23)cc1 |
| InChI | InChI=1S/C22H19NO6S/c1-3-28-14-8-10-15(11-9-14)30(26,27)23-19-12-18-20(22(24)25)13(2)29-21(18)17-7-5-4-6-16(17)19/h4-12,23H,3H2,1-2H3,(H,24,25) |
| InChIKey | PLMQVTXTBNRJNX-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 105.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.46 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |