C20H14FNO5S — CID 7574180
5-[(4-fluorophenyl)sulfonylamino]-2-methylbenzo[g][1]benzofuran-3-carboxylic acid (PubChem CID 7574180) has the molecular formula C20H14FNO5S and a molecular weight of 399.40 g/mol. Its IUPAC name is 5-[(4-fluorophenyl)sulfonylamino]-2-methylbenzo[g][1]benzofuran-3-carboxylic acid.
| Compound Name | 5-[(4-fluorophenyl)sulfonylamino]-2-methylbenzo[g][1]benzofuran-3-carboxylic acid |
|---|---|
| PubChem CID | 7574180 |
| Molecular Formula | C20H14FNO5S |
| Molecular Weight | 399.40 g/mol |
| Exact Mass | 399.06 |
| IUPAC Name | 5-[(4-fluorophenyl)sulfonylamino]-2-methylbenzo[g][1]benzofuran-3-carboxylic acid |
| SMILES | Cc1oc2c(cc(NS(=O)(=O)c3ccc(F)cc3)c3ccccc32)c1C(=O)O |
| InChI | InChI=1S/C20H14FNO5S/c1-11-18(20(23)24)16-10-17(14-4-2-3-5-15(14)19(16)27-11)22-28(25,26)13-8-6-12(21)7-9-13/h2-10,22H,1H3,(H,23,24) |
| InChIKey | PMIYUMRMSFLDJX-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.40 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |