C27H21NO5S — CID 1490255
ethyl 5-(benzenesulfonamido)-2-phenylbenzo[g][1]benzofuran-3-carboxylate (PubChem CID 1490255) has the molecular formula C27H21NO5S and a molecular weight of 471.53 g/mol. Its IUPAC name is ethyl 5-(benzenesulfonamido)-2-phenylbenzo[g][1]benzofuran-3-carboxylate.
| Compound Name | ethyl 5-(benzenesulfonamido)-2-phenylbenzo[g][1]benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 1490255 |
| Molecular Formula | C27H21NO5S |
| Molecular Weight | 471.53 g/mol |
| Exact Mass | 471.11 |
| IUPAC Name | ethyl 5-(benzenesulfonamido)-2-phenylbenzo[g][1]benzofuran-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)oc2c1cc(NS(=O)(=O)c1ccccc1)c1ccccc12 |
| InChI | InChI=1S/C27H21NO5S/c1-2-32-27(29)24-22-17-23(28-34(30,31)19-13-7-4-8-14-19)20-15-9-10-16-21(20)26(22)33-25(24)18-11-5-3-6-12-18/h3-17,28H,2H2,1H3 |
| InChIKey | PJKPENUAVCBHSN-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.53 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |