C23H21NO5S — CID 171977289
ethyl 2-methyl-5-[(4-methylphenyl)sulfamoyl]benzo[g][1]benzofuran-3-carboxylate (PubChem CID 171977289) has the molecular formula C23H21NO5S and a molecular weight of 423.49 g/mol. Its IUPAC name is ethyl 2-methyl-5-[(4-methylphenyl)sulfamoyl]benzo[g][1]benzofuran-3-carboxylate.
| Compound Name | ethyl 2-methyl-5-[(4-methylphenyl)sulfamoyl]benzo[g][1]benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 171977289 |
| Molecular Formula | C23H21NO5S |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | ethyl 2-methyl-5-[(4-methylphenyl)sulfamoyl]benzo[g][1]benzofuran-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)oc2c1cc(S(=O)(=O)Nc1ccc(C)cc1)c1ccccc12 |
| InChI | InChI=1S/C23H21NO5S/c1-4-28-23(25)21-15(3)29-22-18-8-6-5-7-17(18)20(13-19(21)22)30(26,27)24-16-11-9-14(2)10-12-16/h5-13,24H,4H2,1-3H3 |
| InChIKey | ILGCHQOVZBMCAA-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |