C29H33NO5S — CID 2486248
heptyl 5-[(2,5-dimethylphenyl)sulfonylamino]-2-methylbenzo[g][1]benzofuran-3-carboxylate (PubChem CID 2486248) has the molecular formula C29H33NO5S and a molecular weight of 507.65 g/mol. Its IUPAC name is heptyl 5-[(2,5-dimethylphenyl)sulfonylamino]-2-methylbenzo[g][1]benzofuran-3-carboxylate.
| Compound Name | heptyl 5-[(2,5-dimethylphenyl)sulfonylamino]-2-methylbenzo[g][1]benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 2486248 |
| Molecular Formula | C29H33NO5S |
| Molecular Weight | 507.65 g/mol |
| Exact Mass | 507.21 |
| IUPAC Name | heptyl 5-[(2,5-dimethylphenyl)sulfonylamino]-2-methylbenzo[g][1]benzofuran-3-carboxylate |
| SMILES | CCCCCCCOC(=O)c1c(C)oc2c1cc(NS(=O)(=O)c1cc(C)ccc1C)c1ccccc12 |
| InChI | InChI=1S/C29H33NO5S/c1-5-6-7-8-11-16-34-29(31)27-21(4)35-28-23-13-10-9-12-22(23)25(18-24(27)28)30-36(32,33)26-17-19(2)14-15-20(26)3/h9-10,12-15,17-18,30H,5-8,11,16H2,1-4H3 |
| InChIKey | JFEMAJVHMZWSJR-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.65 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|