C26H33NO5S — CID 4855583
pentyl 5-[(4-tert-butylphenyl)sulfonylamino]-2,6-dimethyl-1-benzofuran-3-carboxylate (PubChem CID 4855583) has the molecular formula C26H33NO5S and a molecular weight of 471.62 g/mol. Its IUPAC name is pentyl 5-[(4-tert-butylphenyl)sulfonylamino]-2,6-dimethyl-1-benzofuran-3-carboxylate.
| Compound Name | pentyl 5-[(4-tert-butylphenyl)sulfonylamino]-2,6-dimethyl-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 4855583 |
| Molecular Formula | C26H33NO5S |
| Molecular Weight | 471.62 g/mol |
| Exact Mass | 471.21 |
| IUPAC Name | pentyl 5-[(4-tert-butylphenyl)sulfonylamino]-2,6-dimethyl-1-benzofuran-3-carboxylate |
| SMILES | CCCCCOC(=O)c1c(C)oc2cc(C)c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)cc12 |
| InChI | InChI=1S/C26H33NO5S/c1-7-8-9-14-31-25(28)24-18(3)32-23-15-17(2)22(16-21(23)24)27-33(29,30)20-12-10-19(11-13-20)26(4,5)6/h10-13,15-16,27H,7-9,14H2,1-6H3 |
| InChIKey | BJXYYWLWFLBFNK-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.62 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|