C19H18N2O7S — CID 4089737
ethyl 2-methyl-5-[(2-methyl-5-nitrophenyl)sulfonylamino]-1-benzofuran-3-carboxylate (PubChem CID 4089737) has the molecular formula C19H18N2O7S and a molecular weight of 418.43 g/mol. Its IUPAC name is ethyl 2-methyl-5-[(2-methyl-5-nitrophenyl)sulfonylamino]-1-benzofuran-3-carboxylate.
| Compound Name | ethyl 2-methyl-5-[(2-methyl-5-nitrophenyl)sulfonylamino]-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 4089737 |
| Molecular Formula | C19H18N2O7S |
| Molecular Weight | 418.43 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | ethyl 2-methyl-5-[(2-methyl-5-nitrophenyl)sulfonylamino]-1-benzofuran-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)oc2ccc(NS(=O)(=O)c3cc([N+](=O)[O-])ccc3C)cc12 |
| InChI | InChI=1S/C19H18N2O7S/c1-4-27-19(22)18-12(3)28-16-8-6-13(9-15(16)18)20-29(25,26)17-10-14(21(23)24)7-5-11(17)2/h5-10,20H,4H2,1-3H3 |
| InChIKey | RCOQXAPQYJMRLK-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 128.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.43 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|