C26H20N2O4S — CID 25037352
5-(benzenesulfonamido)-2-methyl-N-phenylbenzo[g][1]benzofuran-3-carboxamide (PubChem CID 25037352) has the molecular formula C26H20N2O4S and a molecular weight of 456.52 g/mol. Its IUPAC name is 5-(benzenesulfonamido)-2-methyl-N-phenylbenzo[g][1]benzofuran-3-carboxamide.
| Compound Name | 5-(benzenesulfonamido)-2-methyl-N-phenylbenzo[g][1]benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 25037352 |
| Molecular Formula | C26H20N2O4S |
| Molecular Weight | 456.52 g/mol |
| Exact Mass | 456.11 |
| IUPAC Name | 5-(benzenesulfonamido)-2-methyl-N-phenylbenzo[g][1]benzofuran-3-carboxamide |
| SMILES | Cc1oc2c(cc(NS(=O)(=O)c3ccccc3)c3ccccc32)c1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C26H20N2O4S/c1-17-24(26(29)27-18-10-4-2-5-11-18)22-16-23(20-14-8-9-15-21(20)25(22)32-17)28-33(30,31)19-12-6-3-7-13-19/h2-16,28H,1H3,(H,27,29) |
| InChIKey | JRIGSOJMFHWAKJ-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.52 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |