C24H21BrN2O4S — CID 25037370
7-bromo-5-[(4-ethylphenyl)sulfonylamino]-2-methyl-N-phenyl-1-benzofuran-3-carboxamide (PubChem CID 25037370) has the molecular formula C24H21BrN2O4S and a molecular weight of 513.41 g/mol. Its IUPAC name is 7-bromo-5-[(4-ethylphenyl)sulfonylamino]-2-methyl-N-phenyl-1-benzofuran-3-carboxamide.
| Compound Name | 7-bromo-5-[(4-ethylphenyl)sulfonylamino]-2-methyl-N-phenyl-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 25037370 |
| Molecular Formula | C24H21BrN2O4S |
| Molecular Weight | 513.41 g/mol |
| Exact Mass | 512.04 |
| IUPAC Name | 7-bromo-5-[(4-ethylphenyl)sulfonylamino]-2-methyl-N-phenyl-1-benzofuran-3-carboxamide |
| SMILES | CCc1ccc(S(=O)(=O)Nc2cc(Br)c3oc(C)c(C(=O)Nc4ccccc4)c3c2)cc1 |
| InChI | InChI=1S/C24H21BrN2O4S/c1-3-16-9-11-19(12-10-16)32(29,30)27-18-13-20-22(15(2)31-23(20)21(25)14-18)24(28)26-17-7-5-4-6-8-17/h4-14,27H,3H2,1-2H3,(H,26,28) |
| InChIKey | VERSFTVNBXNNCP-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.41 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |