C23H19ClN2O4S — CID 25046845
7-chloro-2-methyl-5-[(2-methylphenyl)sulfonylamino]-N-phenyl-1-benzofuran-3-carboxamide (PubChem CID 25046845) has the molecular formula C23H19ClN2O4S and a molecular weight of 454.94 g/mol. Its IUPAC name is 7-chloro-2-methyl-5-[(2-methylphenyl)sulfonylamino]-N-phenyl-1-benzofuran-3-carboxamide.
| Compound Name | 7-chloro-2-methyl-5-[(2-methylphenyl)sulfonylamino]-N-phenyl-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 25046845 |
| Molecular Formula | C23H19ClN2O4S |
| Molecular Weight | 454.94 g/mol |
| Exact Mass | 454.08 |
| IUPAC Name | 7-chloro-2-methyl-5-[(2-methylphenyl)sulfonylamino]-N-phenyl-1-benzofuran-3-carboxamide |
| SMILES | Cc1ccccc1S(=O)(=O)Nc1cc(Cl)c2oc(C)c(C(=O)Nc3ccccc3)c2c1 |
| InChI | InChI=1S/C23H19ClN2O4S/c1-14-8-6-7-11-20(14)31(28,29)26-17-12-18-21(15(2)30-22(18)19(24)13-17)23(27)25-16-9-4-3-5-10-16/h3-13,26H,1-2H3,(H,25,27) |
| InChIKey | KEKXXWMKORPTTG-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.94 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |