About ethyl 7-chloro-5-[(2,5-dibromophenyl)sulfonylamino]-2-methyl-1-benzofuran-3-carboxylate
ethyl 7-chloro-5-[(2,5-dibromophenyl)sulfonylamino]-2-methyl-1-benzofuran-3-carboxylate (PubChem CID 25042342) has the molecular formula C18H14Br2ClNO5S
and a molecular weight of 551.64 g/mol. Its IUPAC name is ethyl 7-chloro-5-[(2,5-dibromophenyl)sulfonylamino]-2-methyl-1-benzofuran-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 7-chloro-5-[(2,5-dibromophenyl)sulfonylamino]-2-methyl-1-benzofuran-3-carboxylate |
| PubChem CID | 25042342 |
| Molecular Formula | C18H14Br2ClNO5S |
| Molecular Weight | 551.64 g/mol |
| Exact Mass | 548.86 |
| IUPAC Name | ethyl 7-chloro-5-[(2,5-dibromophenyl)sulfonylamino]-2-methyl-1-benzofuran-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)oc2c(Cl)cc(NS(=O)(=O)c3cc(Br)ccc3Br)cc12 |
| InChI | InChI=1S/C18H14Br2ClNO5S/c1-3-26-18(23)16-9(2)27-17-12(16)7-11(8-14(17)21)22-28(24,25)15-6-10(19)4-5-13(15)20/h4-8,22H,3H2,1-2H3 |
| InChIKey | ZOYQHSCUIBHUHV-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 551.64 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 7-chloro-5-[(2,5-dibromophenyl)sulfonylamino]-2-methyl-1-benzofuran-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 7-chloro-5-[(2,5-dibromophenyl)sulfonylamino]-2-methyl-1-benzofuran-3-carboxylate?
The IUPAC name of ethyl 7-chloro-5-[(2,5-dibromophenyl)sulfonylamino]-2-methyl-1-benzofuran-3-carboxylate (CID 25042342) is ethyl 7-chloro-5-[(2,5-dibromophenyl)sulfonylamino]-2-methyl-1-benzofuran-3-carboxylate.
What is the SMILES notation for ethyl 7-chloro-5-[(2,5-dibromophenyl)sulfonylamino]-2-methyl-1-benzofuran-3-carboxylate?
The canonical SMILES for ethyl 7-chloro-5-[(2,5-dibromophenyl)sulfonylamino]-2-methyl-1-benzofuran-3-carboxylate is CCOC(=O)c1c(C)oc2c(Cl)cc(NS(=O)(=O)c3cc(Br)ccc3Br)cc12.
What is the InChIKey of ethyl 7-chloro-5-[(2,5-dibromophenyl)sulfonylamino]-2-methyl-1-benzofuran-3-carboxylate?
The InChIKey is ZOYQHSCUIBHUHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14Br2ClNO5S/c1-3-26-18(23)16-9(2)27-17-12(16)7-11(8-14(17)21)22-28(24,25)15-6-10(19)4-5-13(15)20/h4-8,22H,3H2,1-2H3.
What are the key properties of ethyl 7-chloro-5-[(2,5-dibromophenyl)sulfonylamino]-2-methyl-1-benzofuran-3-carboxylate?
ethyl 7-chloro-5-[(2,5-dibromophenyl)sulfonylamino]-2-methyl-1-benzofuran-3-carboxylate has a molecular weight of 551.64 g/mol, XLogP of 5.90, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 7-chloro-5-[(2,5-dibromophenyl)sulfonylamino]-2-methyl-1-benzofuran-3-carboxylate is sourced from PubChem (CID 25042342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).