C12H7Br2Cl2NO3S — CID 107681665
2,4-dibromo-N-(3,5-dichloro-4-hydroxyphenyl)benzenesulfonamide (PubChem CID 107681665) has the molecular formula C12H7Br2Cl2NO3S and a molecular weight of 475.97 g/mol. Its IUPAC name is 2,4-dibromo-N-(3,5-dichloro-4-hydroxyphenyl)benzenesulfonamide.
| Compound Name | 2,4-dibromo-N-(3,5-dichloro-4-hydroxyphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 107681665 |
| Molecular Formula | C12H7Br2Cl2NO3S |
| Molecular Weight | 475.97 g/mol |
| Exact Mass | 472.79 |
| IUPAC Name | 2,4-dibromo-N-(3,5-dichloro-4-hydroxyphenyl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1cc(Cl)c(O)c(Cl)c1)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C12H7Br2Cl2NO3S/c13-6-1-2-11(8(14)3-6)21(19,20)17-7-4-9(15)12(18)10(16)5-7/h1-5,17-18H |
| InChIKey | ABTNZOLHLLPCCJ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.97 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|