About 2,4-dibromo-N-(3-hydroxy-2,4-dimethylphenyl)benzenesulfonamide
2,4-dibromo-N-(3-hydroxy-2,4-dimethylphenyl)benzenesulfonamide (PubChem CID 61061862) has the molecular formula C14H13Br2NO3S
and a molecular weight of 435.14 g/mol. Its IUPAC name is 2,4-dibromo-N-(3-hydroxy-2,4-dimethylphenyl)benzenesulfonamide.
Molecular Properties
| Compound Name | 2,4-dibromo-N-(3-hydroxy-2,4-dimethylphenyl)benzenesulfonamide |
| PubChem CID | 61061862 |
| Molecular Formula | C14H13Br2NO3S |
| Molecular Weight | 435.14 g/mol |
| Exact Mass | 432.90 |
| IUPAC Name | 2,4-dibromo-N-(3-hydroxy-2,4-dimethylphenyl)benzenesulfonamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc(Br)cc2Br)c(C)c1O |
| InChI | InChI=1S/C14H13Br2NO3S/c1-8-3-5-12(9(2)14(8)18)17-21(19,20)13-6-4-10(15)7-11(13)16/h3-7,17-18H,1-2H3 |
| InChIKey | SZRKKMGJLCBHRQ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 435.14 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,4-dibromo-N-(3-hydroxy-2,4-dimethylphenyl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dibromo-N-(3-hydroxy-2,4-dimethylphenyl)benzenesulfonamide?
The IUPAC name of 2,4-dibromo-N-(3-hydroxy-2,4-dimethylphenyl)benzenesulfonamide (CID 61061862) is 2,4-dibromo-N-(3-hydroxy-2,4-dimethylphenyl)benzenesulfonamide.
What is the SMILES notation for 2,4-dibromo-N-(3-hydroxy-2,4-dimethylphenyl)benzenesulfonamide?
The canonical SMILES for 2,4-dibromo-N-(3-hydroxy-2,4-dimethylphenyl)benzenesulfonamide is Cc1ccc(NS(=O)(=O)c2ccc(Br)cc2Br)c(C)c1O.
What is the InChIKey of 2,4-dibromo-N-(3-hydroxy-2,4-dimethylphenyl)benzenesulfonamide?
The InChIKey is SZRKKMGJLCBHRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13Br2NO3S/c1-8-3-5-12(9(2)14(8)18)17-21(19,20)13-6-4-10(15)7-11(13)16/h3-7,17-18H,1-2H3.
What are the key properties of 2,4-dibromo-N-(3-hydroxy-2,4-dimethylphenyl)benzenesulfonamide?
2,4-dibromo-N-(3-hydroxy-2,4-dimethylphenyl)benzenesulfonamide has a molecular weight of 435.14 g/mol, XLogP of 4.33, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dibromo-N-(3-hydroxy-2,4-dimethylphenyl)benzenesulfonamide is sourced from PubChem (CID 61061862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).