C14H13Br2NO3S — CID 61061862
2,4-dibromo-N-(3-hydroxy-2,4-dimethylphenyl)benzenesulfonamide (PubChem CID 61061862) has the molecular formula C14H13Br2NO3S and a molecular weight of 435.14 g/mol. Its IUPAC name is 2,4-dibromo-N-(3-hydroxy-2,4-dimethylphenyl)benzenesulfonamide.
| Compound Name | 2,4-dibromo-N-(3-hydroxy-2,4-dimethylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 61061862 |
| Molecular Formula | C14H13Br2NO3S |
| Molecular Weight | 435.14 g/mol |
| Exact Mass | 432.90 |
| IUPAC Name | 2,4-dibromo-N-(3-hydroxy-2,4-dimethylphenyl)benzenesulfonamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc(Br)cc2Br)c(C)c1O |
| InChI | InChI=1S/C14H13Br2NO3S/c1-8-3-5-12(9(2)14(8)18)17-21(19,20)13-6-4-10(15)7-11(13)16/h3-7,17-18H,1-2H3 |
| InChIKey | SZRKKMGJLCBHRQ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.14 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |