C12H8BrCl2NO3S — CID 82884313
3-bromo-N-(3,5-dichloro-4-hydroxyphenyl)benzenesulfonamide (PubChem CID 82884313) has the molecular formula C12H8BrCl2NO3S and a molecular weight of 397.08 g/mol. Its IUPAC name is 3-bromo-N-(3,5-dichloro-4-hydroxyphenyl)benzenesulfonamide.
| Compound Name | 3-bromo-N-(3,5-dichloro-4-hydroxyphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 82884313 |
| Molecular Formula | C12H8BrCl2NO3S |
| Molecular Weight | 397.08 g/mol |
| Exact Mass | 394.88 |
| IUPAC Name | 3-bromo-N-(3,5-dichloro-4-hydroxyphenyl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1cc(Cl)c(O)c(Cl)c1)c1cccc(Br)c1 |
| InChI | InChI=1S/C12H8BrCl2NO3S/c13-7-2-1-3-9(4-7)20(18,19)16-8-5-10(14)12(17)11(15)6-8/h1-6,16-17H |
| InChIKey | QNJNJOSZVDOJON-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.08 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|