C12H8BrCl2NO2S — CID 3833840
3-bromo-N-(3,5-dichlorophenyl)benzenesulfonamide (PubChem CID 3833840) has the molecular formula C12H8BrCl2NO2S and a molecular weight of 381.08 g/mol. Its IUPAC name is 3-bromo-N-(3,5-dichlorophenyl)benzenesulfonamide.
| Compound Name | 3-bromo-N-(3,5-dichlorophenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 3833840 |
| Molecular Formula | C12H8BrCl2NO2S |
| Molecular Weight | 381.08 g/mol |
| Exact Mass | 378.88 |
| IUPAC Name | 3-bromo-N-(3,5-dichlorophenyl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1cc(Cl)cc(Cl)c1)c1cccc(Br)c1 |
| InChI | InChI=1S/C12H8BrCl2NO2S/c13-8-2-1-3-12(4-8)19(17,18)16-11-6-9(14)5-10(15)7-11/h1-7,16H |
| InChIKey | HVFRVLJOSLSEAL-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.08 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |