C15H14BrNO2S — CID 5019685
3-bromo-N-(2,3-dihydro-1H-inden-5-yl)benzenesulfonamide (PubChem CID 5019685) has the molecular formula C15H14BrNO2S and a molecular weight of 352.25 g/mol. Its IUPAC name is 3-bromo-N-(2,3-dihydro-1H-inden-5-yl)benzenesulfonamide.
| Compound Name | 3-bromo-N-(2,3-dihydro-1H-inden-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 5019685 |
| Molecular Formula | C15H14BrNO2S |
| Molecular Weight | 352.25 g/mol |
| Exact Mass | 350.99 |
| IUPAC Name | 3-bromo-N-(2,3-dihydro-1H-inden-5-yl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc2c(c1)CCC2)c1cccc(Br)c1 |
| InChI | InChI=1S/C15H14BrNO2S/c16-13-5-2-6-15(10-13)20(18,19)17-14-8-7-11-3-1-4-12(11)9-14/h2,5-10,17H,1,3-4H2 |
| InChIKey | NFKOVAKGAXGGRZ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.25 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |