C16H16BrNO2S — CID 114298978
N-[3-(bromomethyl)phenyl]-2,3-dihydro-1H-indene-5-sulfonamide (PubChem CID 114298978) has the molecular formula C16H16BrNO2S and a molecular weight of 366.28 g/mol. Its IUPAC name is N-[3-(bromomethyl)phenyl]-2,3-dihydro-1H-indene-5-sulfonamide.
| Compound Name | N-[3-(bromomethyl)phenyl]-2,3-dihydro-1H-indene-5-sulfonamide |
|---|---|
| PubChem CID | 114298978 |
| Molecular Formula | C16H16BrNO2S |
| Molecular Weight | 366.28 g/mol |
| Exact Mass | 365.01 |
| IUPAC Name | N-[3-(bromomethyl)phenyl]-2,3-dihydro-1H-indene-5-sulfonamide |
| SMILES | O=S(=O)(Nc1cccc(CBr)c1)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C16H16BrNO2S/c17-11-12-3-1-6-15(9-12)18-21(19,20)16-8-7-13-4-2-5-14(13)10-16/h1,3,6-10,18H,2,4-5,11H2 |
| InChIKey | RMVZKBCWNTXIEE-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.28 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|