C14H13ClN2O2S — CID 103944070
N-(2-chloro-4-pyridinyl)-2,3-dihydro-1H-indene-5-sulfonamide (PubChem CID 103944070) has the molecular formula C14H13ClN2O2S and a molecular weight of 308.79 g/mol. Its IUPAC name is N-(2-chloro-4-pyridinyl)-2,3-dihydro-1H-indene-5-sulfonamide.
| Compound Name | N-(2-chloro-4-pyridinyl)-2,3-dihydro-1H-indene-5-sulfonamide |
|---|---|
| PubChem CID | 103944070 |
| Molecular Formula | C14H13ClN2O2S |
| Molecular Weight | 308.79 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | N-(2-chloro-4-pyridinyl)-2,3-dihydro-1H-indene-5-sulfonamide |
| SMILES | O=S(=O)(Nc1ccnc(Cl)c1)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C14H13ClN2O2S/c15-14-9-12(6-7-16-14)17-20(18,19)13-5-4-10-2-1-3-11(10)8-13/h4-9H,1-3H2,(H,16,17) |
| InChIKey | PKNRZHQLZPYWBA-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.79 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|