C15H13ClINO2S — CID 107606873
N-(2-chloro-4-iodophenyl)-2,3-dihydro-1H-indene-5-sulfonamide (PubChem CID 107606873) has the molecular formula C15H13ClINO2S and a molecular weight of 433.70 g/mol. Its IUPAC name is N-(2-chloro-4-iodophenyl)-2,3-dihydro-1H-indene-5-sulfonamide.
| Compound Name | N-(2-chloro-4-iodophenyl)-2,3-dihydro-1H-indene-5-sulfonamide |
|---|---|
| PubChem CID | 107606873 |
| Molecular Formula | C15H13ClINO2S |
| Molecular Weight | 433.70 g/mol |
| Exact Mass | 432.94 |
| IUPAC Name | N-(2-chloro-4-iodophenyl)-2,3-dihydro-1H-indene-5-sulfonamide |
| SMILES | O=S(=O)(Nc1ccc(I)cc1Cl)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C15H13ClINO2S/c16-14-9-12(17)5-7-15(14)18-21(19,20)13-6-4-10-2-1-3-11(10)8-13/h4-9,18H,1-3H2 |
| InChIKey | IKBMQNITIQRBLP-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.70 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|