C12H8ClF3N2O2S — CID 103944025
N-(2-chloro-4-pyridinyl)-4-(trifluoromethyl)benzenesulfonamide (PubChem CID 103944025) has the molecular formula C12H8ClF3N2O2S and a molecular weight of 336.72 g/mol. Its IUPAC name is N-(2-chloro-4-pyridinyl)-4-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-(2-chloro-4-pyridinyl)-4-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 103944025 |
| Molecular Formula | C12H8ClF3N2O2S |
| Molecular Weight | 336.72 g/mol |
| Exact Mass | 335.99 |
| IUPAC Name | N-(2-chloro-4-pyridinyl)-4-(trifluoromethyl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccnc(Cl)c1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H8ClF3N2O2S/c13-11-7-9(5-6-17-11)18-21(19,20)10-3-1-8(2-4-10)12(14,15)16/h1-7H,(H,17,18) |
| InChIKey | VJKBQJBASPUICX-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.72 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|