C14H13FN2O2S — CID 84598051
N-(3-fluoro-2-pyridinyl)-2,3-dihydro-1H-indene-5-sulfonamide (PubChem CID 84598051) has the molecular formula C14H13FN2O2S and a molecular weight of 292.33 g/mol. Its IUPAC name is N-(3-fluoro-2-pyridinyl)-2,3-dihydro-1H-indene-5-sulfonamide.
| Compound Name | N-(3-fluoro-2-pyridinyl)-2,3-dihydro-1H-indene-5-sulfonamide |
|---|---|
| PubChem CID | 84598051 |
| Molecular Formula | C14H13FN2O2S |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | N-(3-fluoro-2-pyridinyl)-2,3-dihydro-1H-indene-5-sulfonamide |
| SMILES | O=S(=O)(Nc1ncccc1F)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C14H13FN2O2S/c15-13-5-2-8-16-14(13)17-20(18,19)12-7-6-10-3-1-4-11(10)9-12/h2,5-9H,1,3-4H2,(H,16,17) |
| InChIKey | UGTPQJWQPNPCMC-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |