C15H15BrN2O2S — CID 43258379
2-amino-4-bromo-N-(2,3-dihydro-1H-inden-5-yl)benzenesulfonamide (PubChem CID 43258379) has the molecular formula C15H15BrN2O2S and a molecular weight of 367.27 g/mol. Its IUPAC name is 2-amino-4-bromo-N-(2,3-dihydro-1H-inden-5-yl)benzenesulfonamide.
| Compound Name | 2-amino-4-bromo-N-(2,3-dihydro-1H-inden-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 43258379 |
| Molecular Formula | C15H15BrN2O2S |
| Molecular Weight | 367.27 g/mol |
| Exact Mass | 366.00 |
| IUPAC Name | 2-amino-4-bromo-N-(2,3-dihydro-1H-inden-5-yl)benzenesulfonamide |
| SMILES | Nc1cc(Br)ccc1S(=O)(=O)Nc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C15H15BrN2O2S/c16-12-5-7-15(14(17)9-12)21(19,20)18-13-6-4-10-2-1-3-11(10)8-13/h4-9,18H,1-3,17H2 |
| InChIKey | XGJAWGAHJQOVMV-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.27 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|