C12H7BrCl2FNO3S — CID 116527677
4-bromo-N-(3,5-dichloro-4-hydroxyphenyl)-2-fluorobenzenesulfonamide (PubChem CID 116527677) has the molecular formula C12H7BrCl2FNO3S and a molecular weight of 415.07 g/mol. Its IUPAC name is 4-bromo-N-(3,5-dichloro-4-hydroxyphenyl)-2-fluorobenzenesulfonamide.
| Compound Name | 4-bromo-N-(3,5-dichloro-4-hydroxyphenyl)-2-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 116527677 |
| Molecular Formula | C12H7BrCl2FNO3S |
| Molecular Weight | 415.07 g/mol |
| Exact Mass | 412.87 |
| IUPAC Name | 4-bromo-N-(3,5-dichloro-4-hydroxyphenyl)-2-fluorobenzenesulfonamide |
| SMILES | O=S(=O)(Nc1cc(Cl)c(O)c(Cl)c1)c1ccc(Br)cc1F |
| InChI | InChI=1S/C12H7BrCl2FNO3S/c13-6-1-2-11(10(16)3-6)21(19,20)17-7-4-8(14)12(18)9(15)5-7/h1-5,17-18H |
| InChIKey | RWUVPYRMVQDWRJ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.07 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|