C13H10BrCl2NO3S — CID 103878560
2-bromo-N-(3,5-dichloro-4-hydroxyphenyl)-4-methylbenzenesulfonamide (PubChem CID 103878560) has the molecular formula C13H10BrCl2NO3S and a molecular weight of 411.10 g/mol. Its IUPAC name is 2-bromo-N-(3,5-dichloro-4-hydroxyphenyl)-4-methylbenzenesulfonamide.
| Compound Name | 2-bromo-N-(3,5-dichloro-4-hydroxyphenyl)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 103878560 |
| Molecular Formula | C13H10BrCl2NO3S |
| Molecular Weight | 411.10 g/mol |
| Exact Mass | 408.89 |
| IUPAC Name | 2-bromo-N-(3,5-dichloro-4-hydroxyphenyl)-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2cc(Cl)c(O)c(Cl)c2)c(Br)c1 |
| InChI | InChI=1S/C13H10BrCl2NO3S/c1-7-2-3-12(9(14)4-7)21(19,20)17-8-5-10(15)13(18)11(16)6-8/h2-6,17-18H,1H3 |
| InChIKey | FQBMKFJIHLWEPI-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.10 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|