C14H13BrFNO4S — CID 98000872
4-bromo-N-(3,5-dimethoxyphenyl)-2-fluorobenzenesulfonamide (PubChem CID 98000872) has the molecular formula C14H13BrFNO4S and a molecular weight of 390.23 g/mol. Its IUPAC name is 4-bromo-N-(3,5-dimethoxyphenyl)-2-fluorobenzenesulfonamide.
| Compound Name | 4-bromo-N-(3,5-dimethoxyphenyl)-2-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 98000872 |
| Molecular Formula | C14H13BrFNO4S |
| Molecular Weight | 390.23 g/mol |
| Exact Mass | 388.97 |
| IUPAC Name | 4-bromo-N-(3,5-dimethoxyphenyl)-2-fluorobenzenesulfonamide |
| SMILES | COc1cc(NS(=O)(=O)c2ccc(Br)cc2F)cc(OC)c1 |
| InChI | InChI=1S/C14H13BrFNO4S/c1-20-11-6-10(7-12(8-11)21-2)17-22(18,19)14-4-3-9(15)5-13(14)16/h3-8,17H,1-2H3 |
| InChIKey | ISDUMJZTTOHVGT-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.23 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |