C12H7Br2Cl2NO2S — CID 60823150
2,4-dibromo-N-(2,3-dichlorophenyl)benzenesulfonamide (PubChem CID 60823150) has the molecular formula C12H7Br2Cl2NO2S and a molecular weight of 459.97 g/mol. Its IUPAC name is 2,4-dibromo-N-(2,3-dichlorophenyl)benzenesulfonamide.
| Compound Name | 2,4-dibromo-N-(2,3-dichlorophenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 60823150 |
| Molecular Formula | C12H7Br2Cl2NO2S |
| Molecular Weight | 459.97 g/mol |
| Exact Mass | 456.79 |
| IUPAC Name | 2,4-dibromo-N-(2,3-dichlorophenyl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1cccc(Cl)c1Cl)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C12H7Br2Cl2NO2S/c13-7-4-5-11(8(14)6-7)20(18,19)17-10-3-1-2-9(15)12(10)16/h1-6,17H |
| InChIKey | LUYYECPPGLKTQO-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.97 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |