C20H20N2O4S2 — CID 23387080
1-N,2-N-bis(4-methylphenyl)benzene-1,2-disulfonamide (PubChem CID 23387080) has the molecular formula C20H20N2O4S2 and a molecular weight of 416.52 g/mol. Its IUPAC name is 1-N,2-N-bis(4-methylphenyl)benzene-1,2-disulfonamide.
| Compound Name | 1-N,2-N-bis(4-methylphenyl)benzene-1,2-disulfonamide |
|---|---|
| PubChem CID | 23387080 |
| Molecular Formula | C20H20N2O4S2 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.09 |
| IUPAC Name | 1-N,2-N-bis(4-methylphenyl)benzene-1,2-disulfonamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccccc2S(=O)(=O)Nc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C20H20N2O4S2/c1-15-7-11-17(12-8-15)21-27(23,24)19-5-3-4-6-20(19)28(25,26)22-18-13-9-16(2)10-14-18/h3-14,21-22H,1-2H3 |
| InChIKey | WCDPLMLTGDTPLO-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |