C16H16N2O3S — CID 22483846
N-[2-[(4-methylphenyl)sulfamoyl]phenyl]prop-2-enamide (PubChem CID 22483846) has the molecular formula C16H16N2O3S and a molecular weight of 316.38 g/mol. Its IUPAC name is N-[2-[(4-methylphenyl)sulfamoyl]phenyl]prop-2-enamide.
| Compound Name | N-[2-[(4-methylphenyl)sulfamoyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 22483846 |
| Molecular Formula | C16H16N2O3S |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | N-[2-[(4-methylphenyl)sulfamoyl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccccc1S(=O)(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C16H16N2O3S/c1-3-16(19)17-14-6-4-5-7-15(14)22(20,21)18-13-10-8-12(2)9-11-13/h3-11,18H,1H2,2H3,(H,17,19) |
| InChIKey | HVQWYAQVXRFMNF-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|