C23H23N3O7S2 — CID 138617468
ethyl 4-[[2-[(4-methylphenyl)sulfonylcarbamoylamino]phenyl]sulfonylamino]benzoate (PubChem CID 138617468) has the molecular formula C23H23N3O7S2 and a molecular weight of 517.59 g/mol. Its IUPAC name is ethyl 4-[[2-[(4-methylphenyl)sulfonylcarbamoylamino]phenyl]sulfonylamino]benzoate.
| Compound Name | ethyl 4-[[2-[(4-methylphenyl)sulfonylcarbamoylamino]phenyl]sulfonylamino]benzoate |
|---|---|
| PubChem CID | 138617468 |
| Molecular Formula | C23H23N3O7S2 |
| Molecular Weight | 517.59 g/mol |
| Exact Mass | 517.10 |
| IUPAC Name | ethyl 4-[[2-[(4-methylphenyl)sulfonylcarbamoylamino]phenyl]sulfonylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NS(=O)(=O)c2ccccc2NC(=O)NS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C23H23N3O7S2/c1-3-33-22(27)17-10-12-18(13-11-17)25-35(31,32)21-7-5-4-6-20(21)24-23(28)26-34(29,30)19-14-8-16(2)9-15-19/h4-15,25H,3H2,1-2H3,(H2,24,26,28) |
| InChIKey | LRVNTNRIFCMVJM-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 147.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.59 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |