C15H17N3O4S — CID 90419987
ethyl 4-[(2,3-diaminophenyl)sulfonylamino]benzoate (PubChem CID 90419987) has the molecular formula C15H17N3O4S and a molecular weight of 335.39 g/mol. Its IUPAC name is ethyl 4-[(2,3-diaminophenyl)sulfonylamino]benzoate.
| Compound Name | ethyl 4-[(2,3-diaminophenyl)sulfonylamino]benzoate |
|---|---|
| PubChem CID | 90419987 |
| Molecular Formula | C15H17N3O4S |
| Molecular Weight | 335.39 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | ethyl 4-[(2,3-diaminophenyl)sulfonylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NS(=O)(=O)c2cccc(N)c2N)cc1 |
| InChI | InChI=1S/C15H17N3O4S/c1-2-22-15(19)10-6-8-11(9-7-10)18-23(20,21)13-5-3-4-12(16)14(13)17/h3-9,18H,2,16-17H2,1H3 |
| InChIKey | DNZGATYQLSAZPK-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 124.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.39 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|