C29H27N5O6S — CID 146421969
ethyl 4-[[2,4-bis(phenylcarbamoylamino)phenyl]sulfonylamino]benzoate (PubChem CID 146421969) has the molecular formula C29H27N5O6S and a molecular weight of 573.63 g/mol. Its IUPAC name is ethyl 4-[[2,4-bis(phenylcarbamoylamino)phenyl]sulfonylamino]benzoate.
| Compound Name | ethyl 4-[[2,4-bis(phenylcarbamoylamino)phenyl]sulfonylamino]benzoate |
|---|---|
| PubChem CID | 146421969 |
| Molecular Formula | C29H27N5O6S |
| Molecular Weight | 573.63 g/mol |
| Exact Mass | 573.17 |
| IUPAC Name | ethyl 4-[[2,4-bis(phenylcarbamoylamino)phenyl]sulfonylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NS(=O)(=O)c2ccc(NC(=O)Nc3ccccc3)cc2NC(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C29H27N5O6S/c1-2-40-27(35)20-13-15-23(16-14-20)34-41(38,39)26-18-17-24(32-28(36)30-21-9-5-3-6-10-21)19-25(26)33-29(37)31-22-11-7-4-8-12-22/h3-19,34H,2H2,1H3,(H2,30,32,36)(H2,31,33,37) |
| InChIKey | TXSCPWYAUDVMLR-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 154.73 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.63 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |